C15H19FN2O5S — CID 35434056
[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 2-(3-fluorophenyl)acetate (PubChem CID 35434056) has the molecular formula C15H19FN2O5S and a molecular weight of 358.39 g/mol. Its IUPAC name is [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 2-(3-fluorophenyl)acetate.
| Compound Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 35434056 |
| Molecular Formula | C15H19FN2O5S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 2-(3-fluorophenyl)acetate |
| SMILES | CS(=O)(=O)N1CCN(C(=O)COC(=O)Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H19FN2O5S/c1-24(21,22)18-7-5-17(6-8-18)14(19)11-23-15(20)10-12-3-2-4-13(16)9-12/h2-4,9H,5-8,10-11H2,1H3 |
| InChIKey | OEOKNTNUNXMXIH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |