C21H23FN2O4 — CID 9346964
[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(3-methoxyphenyl)acetate (PubChem CID 9346964) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(3-methoxyphenyl)acetate.
| Compound Name | [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 9346964 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(3-methoxyphenyl)acetate |
| SMILES | COc1cccc(CC(=O)OCC(=O)N2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C21H23FN2O4/c1-27-17-6-4-5-16(13-17)14-21(26)28-15-20(25)24-11-9-23(10-12-24)19-8-3-2-7-18(19)22/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | OVRAMQZYCQBWCY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |