C24H23FN2O4 — CID 9483758
[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-naphthalen-2-yloxyacetate (PubChem CID 9483758) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-naphthalen-2-yloxyacetate.
| Compound Name | [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
|---|---|
| PubChem CID | 9483758 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
| SMILES | O=C(COc1ccc2ccccc2c1)OCC(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H23FN2O4/c25-21-7-3-4-8-22(21)26-11-13-27(14-12-26)23(28)16-31-24(29)17-30-20-10-9-18-5-1-2-6-19(18)15-20/h1-10,15H,11-14,16-17H2 |
| InChIKey | ZRVPXVKPILSNSB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |