C18H24FN3O3 — CID 7328592
2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 7328592) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 7328592 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(COCC(=O)N1CCN(c2ccccc2F)CC1)N1CCCC1 |
| InChI | InChI=1S/C18H24FN3O3/c19-15-5-1-2-6-16(15)20-9-11-22(12-10-20)18(24)14-25-13-17(23)21-7-3-4-8-21/h1-2,5-6H,3-4,7-14H2 |
| InChIKey | LAABNBFTRGSCFY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |