C16H20FN3O2 — CID 108521142
1-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione (PubChem CID 108521142) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione.
| Compound Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 108521142 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(c2ccccc2F)CC1)N1CCCC1 |
| InChI | InChI=1S/C16H20FN3O2/c17-13-5-1-2-6-14(13)18-9-11-20(12-10-18)16(22)15(21)19-7-3-4-8-19/h1-2,5-6H,3-4,7-12H2 |
| InChIKey | JBSYPLXCNYKHOT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|