C18H24FN3O2 — CID 108504673
1-[4-(2-fluorophenyl)piperazin-1-yl]-2-(4-methylpiperidin-1-yl)ethane-1,2-dione (PubChem CID 108504673) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-(4-methylpiperidin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-(4-methylpiperidin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 108504673 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-(4-methylpiperidin-1-yl)ethane-1,2-dione |
| SMILES | CC1CCN(C(=O)C(=O)N2CCN(c3ccccc3F)CC2)CC1 |
| InChI | InChI=1S/C18H24FN3O2/c1-14-6-8-21(9-7-14)17(23)18(24)22-12-10-20(11-13-22)16-5-3-2-4-15(16)19/h2-5,14H,6-13H2,1H3 |
| InChIKey | GHZMEKFKVXZACF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|