C20H26FN3O2 — CID 34228816
cyclopropyl-[4-[4-(2-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]methanone (PubChem CID 34228816) has the molecular formula C20H26FN3O2 and a molecular weight of 359.45 g/mol. Its IUPAC name is cyclopropyl-[4-[4-(2-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[4-(2-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 34228816 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | cyclopropyl-[4-[4-(2-fluorophenyl)piperazine-1-carbonyl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCC(C(=O)N2CCN(c3ccccc3F)CC2)CC1 |
| InChI | InChI=1S/C20H26FN3O2/c21-17-3-1-2-4-18(17)22-11-13-24(14-12-22)20(26)16-7-9-23(10-8-16)19(25)15-5-6-15/h1-4,15-16H,5-14H2 |
| InChIKey | SEKBNHVZLHRBKS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |