C22H25F2N3O — CID 17152590
[4-(4-fluorophenyl)piperazin-1-yl]-[1-(2-fluorophenyl)piperidin-4-yl]methanone (PubChem CID 17152590) has the molecular formula C22H25F2N3O and a molecular weight of 385.46 g/mol. Its IUPAC name is [4-(4-fluorophenyl)piperazin-1-yl]-[1-(2-fluorophenyl)piperidin-4-yl]methanone.
| Compound Name | [4-(4-fluorophenyl)piperazin-1-yl]-[1-(2-fluorophenyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 17152590 |
| Molecular Formula | C22H25F2N3O |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [4-(4-fluorophenyl)piperazin-1-yl]-[1-(2-fluorophenyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ccccc2F)CC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H25F2N3O/c23-18-5-7-19(8-6-18)25-13-15-27(16-14-25)22(28)17-9-11-26(12-10-17)21-4-2-1-3-20(21)24/h1-8,17H,9-16H2 |
| InChIKey | UTVQUUMTZMPNHM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |