C14H16F2N2O — CID 113081215
cyclopropyl-[4-(2,6-difluorophenyl)piperazin-1-yl]methanone (PubChem CID 113081215) has the molecular formula C14H16F2N2O and a molecular weight of 266.29 g/mol. Its IUPAC name is cyclopropyl-[4-(2,6-difluorophenyl)piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-(2,6-difluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 113081215 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | cyclopropyl-[4-(2,6-difluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCN(c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C14H16F2N2O/c15-11-2-1-3-12(16)13(11)17-6-8-18(9-7-17)14(19)10-4-5-10/h1-3,10H,4-9H2 |
| InChIKey | QMUYTXLVXCSQSB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |