C14H17F2N3O — CID 113081283
N-cyclopropyl-4-(2,6-difluorophenyl)piperazine-1-carboxamide (PubChem CID 113081283) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is N-cyclopropyl-4-(2,6-difluorophenyl)piperazine-1-carboxamide.
| Compound Name | N-cyclopropyl-4-(2,6-difluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113081283 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-cyclopropyl-4-(2,6-difluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(NC1CC1)N1CCN(c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C14H17F2N3O/c15-11-2-1-3-12(16)13(11)18-6-8-19(9-7-18)14(20)17-10-4-5-10/h1-3,10H,4-9H2,(H,17,20) |
| InChIKey | BYCUSNCRZHCKTH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |