C18H23F2N3O2 — CID 47784765
N-cyclohexyl-4-(2,6-difluorobenzoyl)piperazine-1-carboxamide (PubChem CID 47784765) has the molecular formula C18H23F2N3O2 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,6-difluorobenzoyl)piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(2,6-difluorobenzoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 47784765 |
| Molecular Formula | C18H23F2N3O2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-cyclohexyl-4-(2,6-difluorobenzoyl)piperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCN(C(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C18H23F2N3O2/c19-14-7-4-8-15(20)16(14)17(24)22-9-11-23(12-10-22)18(25)21-13-5-2-1-3-6-13/h4,7-8,13H,1-3,5-6,9-12H2,(H,21,25) |
| InChIKey | DOLZLADAWWHNGH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |