C19H28FN3O — CID 113107381
N-cycloheptyl-4-[(2-fluorophenyl)methyl]piperazine-1-carboxamide (PubChem CID 113107381) has the molecular formula C19H28FN3O and a molecular weight of 333.45 g/mol. Its IUPAC name is N-cycloheptyl-4-[(2-fluorophenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-cycloheptyl-4-[(2-fluorophenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113107381 |
| Molecular Formula | C19H28FN3O |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N-cycloheptyl-4-[(2-fluorophenyl)methyl]piperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCCC1)N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C19H28FN3O/c20-18-10-6-5-7-16(18)15-22-11-13-23(14-12-22)19(24)21-17-8-3-1-2-4-9-17/h5-7,10,17H,1-4,8-9,11-15H2,(H,21,24) |
| InChIKey | QRVLAUVKHNIGQO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |