C19H26N4O2 — CID 33409511
4-(1,3-benzoxazol-2-ylmethyl)-N-cyclohexylpiperazine-1-carboxamide (PubChem CID 33409511) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylmethyl)-N-cyclohexylpiperazine-1-carboxamide.
| Compound Name | 4-(1,3-benzoxazol-2-ylmethyl)-N-cyclohexylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 33409511 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylmethyl)-N-cyclohexylpiperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCN(Cc2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C19H26N4O2/c24-19(20-15-6-2-1-3-7-15)23-12-10-22(11-13-23)14-18-21-16-8-4-5-9-17(16)25-18/h4-5,8-9,15H,1-3,6-7,10-14H2,(H,20,24) |
| InChIKey | XAPGGVBDZBOPNY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |