C15H19N3O2 — CID 110747198
1-(1,3-benzoxazol-2-ylmethyl)-3-cyclohexylurea (PubChem CID 110747198) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-ylmethyl)-3-cyclohexylurea.
| Compound Name | 1-(1,3-benzoxazol-2-ylmethyl)-3-cyclohexylurea |
|---|---|
| PubChem CID | 110747198 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-(1,3-benzoxazol-2-ylmethyl)-3-cyclohexylurea |
| SMILES | O=C(NCc1nc2ccccc2o1)NC1CCCCC1 |
| InChI | InChI=1S/C15H19N3O2/c19-15(17-11-6-2-1-3-7-11)16-10-14-18-12-8-4-5-9-13(12)20-14/h4-5,8-9,11H,1-3,6-7,10H2,(H2,16,17,19) |
| InChIKey | FLXSDDXAPZCTBE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |