C18H24N4O2 — CID 53078498
4-(1,3-benzoxazol-2-ylmethyl)-N-cyclopentylpiperazine-1-carboxamide (PubChem CID 53078498) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylmethyl)-N-cyclopentylpiperazine-1-carboxamide.
| Compound Name | 4-(1,3-benzoxazol-2-ylmethyl)-N-cyclopentylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 53078498 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylmethyl)-N-cyclopentylpiperazine-1-carboxamide |
| SMILES | O=C(NC1CCCC1)N1CCN(Cc2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C18H24N4O2/c23-18(19-14-5-1-2-6-14)22-11-9-21(10-12-22)13-17-20-15-7-3-4-8-16(15)24-17/h3-4,7-8,14H,1-2,5-6,9-13H2,(H,19,23) |
| InChIKey | UUDZGZSBPPRUBT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |