C17H22N2O3 — CID 146038837
2-(1,3-benzoxazol-2-yl)-N-[(1S,2S)-2-hydroxycyclooctyl]acetamide (PubChem CID 146038837) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-N-[(1S,2S)-2-hydroxycyclooctyl]acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-N-[(1S,2S)-2-hydroxycyclooctyl]acetamide |
|---|---|
| PubChem CID | 146038837 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-N-[(1S,2S)-2-hydroxycyclooctyl]acetamide |
| SMILES | O=C(Cc1nc2ccccc2o1)N[C@H]1CCCCCC[C@@H]1O |
| InChI | InChI=1S/C17H22N2O3/c20-14-9-4-2-1-3-7-12(14)18-16(21)11-17-19-13-8-5-6-10-15(13)22-17/h5-6,8,10,12,14,20H,1-4,7,9,11H2,(H,18,21)/t12-,14-/m0/s1 |
| InChIKey | PPKRHHGKQHAFFQ-JSGCOSHPSA-N |
| XLogP | 2.57 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |