C14H15NO3 — CID 62214070
2-(1,3-benzoxazol-2-yl)-1-(oxan-2-yl)ethanone (PubChem CID 62214070) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(oxan-2-yl)ethanone.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(oxan-2-yl)ethanone |
|---|---|
| PubChem CID | 62214070 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(oxan-2-yl)ethanone |
| SMILES | O=C(Cc1nc2ccccc2o1)C1CCCCO1 |
| InChI | InChI=1S/C14H15NO3/c16-11(13-7-3-4-8-17-13)9-14-15-10-5-1-2-6-12(10)18-14/h1-2,5-6,13H,3-4,7-9H2 |
| InChIKey | FVMUPBGNERKSLQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |