C9H6NNaO3 — CID 75531246
sodium 2-(1,3-benzoxazol-2-yl)acetate (PubChem CID 75531246) has the molecular formula C9H6NNaO3 and a molecular weight of 199.14 g/mol. Its IUPAC name is sodium 2-(1,3-benzoxazol-2-yl)acetate.
| Compound Name | sodium 2-(1,3-benzoxazol-2-yl)acetate |
|---|---|
| PubChem CID | 75531246 |
| Molecular Formula | C9H6NNaO3 |
| Molecular Weight | 199.14 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | sodium 2-(1,3-benzoxazol-2-yl)acetate |
| SMILES | O=C([O-])Cc1nc2ccccc2o1.[Na+] |
| InChI | InChI=1S/C9H7NO3.Na/c11-9(12)5-8-10-6-3-1-2-4-7(6)13-8;/h1-4H,5H2,(H,11,12);/q;+1/p-1 |
| InChIKey | HAQQDWJWLYKACO-UHFFFAOYSA-M |
| XLogP | -2.88 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.14 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |