C15H9BrClNO2 — CID 107989036
2-(1,3-benzoxazol-2-yl)-1-(3-bromo-4-chlorophenyl)ethanone (PubChem CID 107989036) has the molecular formula C15H9BrClNO2 and a molecular weight of 350.60 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(3-bromo-4-chlorophenyl)ethanone.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(3-bromo-4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 107989036 |
| Molecular Formula | C15H9BrClNO2 |
| Molecular Weight | 350.60 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(3-bromo-4-chlorophenyl)ethanone |
| SMILES | O=C(Cc1nc2ccccc2o1)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C15H9BrClNO2/c16-10-7-9(5-6-11(10)17)13(19)8-15-18-12-3-1-2-4-14(12)20-15/h1-7H,8H2 |
| InChIKey | WXJNFTCUHDOVQS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |