C16H12FNO3 — CID 62919555
2-(1,3-benzoxazol-2-yl)-1-(3-fluoro-4-methoxyphenyl)ethanone (PubChem CID 62919555) has the molecular formula C16H12FNO3 and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(3-fluoro-4-methoxyphenyl)ethanone.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(3-fluoro-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 62919555 |
| Molecular Formula | C16H12FNO3 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(3-fluoro-4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2nc3ccccc3o2)cc1F |
| InChI | InChI=1S/C16H12FNO3/c1-20-14-7-6-10(8-11(14)17)13(19)9-16-18-12-4-2-3-5-15(12)21-16/h2-8H,9H2,1H3 |
| InChIKey | PFQOIOIADMUWOS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |