C16H12BrNO2 — CID 81472639
2-(1,3-benzoxazol-2-yl)-1-(3-bromo-4-methylphenyl)ethanone (PubChem CID 81472639) has the molecular formula C16H12BrNO2 and a molecular weight of 330.18 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(3-bromo-4-methylphenyl)ethanone.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(3-bromo-4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 81472639 |
| Molecular Formula | C16H12BrNO2 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(3-bromo-4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)Cc2nc3ccccc3o2)cc1Br |
| InChI | InChI=1S/C16H12BrNO2/c1-10-6-7-11(8-12(10)17)14(19)9-16-18-13-4-2-3-5-15(13)20-16/h2-8H,9H2,1H3 |
| InChIKey | VMLUGCAUIPHFSX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |