C15H8F3NO2 — CID 65099002
2-(1,3-benzoxazol-2-yl)-1-(2,4,6-trifluorophenyl)ethanone (PubChem CID 65099002) has the molecular formula C15H8F3NO2 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(2,4,6-trifluorophenyl)ethanone.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(2,4,6-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 65099002 |
| Molecular Formula | C15H8F3NO2 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(2,4,6-trifluorophenyl)ethanone |
| SMILES | O=C(Cc1nc2ccccc2o1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C15H8F3NO2/c16-8-5-9(17)15(10(18)6-8)12(20)7-14-19-11-3-1-2-4-13(11)21-14/h1-6H,7H2 |
| InChIKey | IGEFXRZAXMMWNN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |