C14H17NO2 — CID 28934808
1-(1,3-benzoxazol-2-yl)-5-methylhexan-2-one (PubChem CID 28934808) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-5-methylhexan-2-one.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-5-methylhexan-2-one |
|---|---|
| PubChem CID | 28934808 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-5-methylhexan-2-one |
| SMILES | CC(C)CCC(=O)Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H17NO2/c1-10(2)7-8-11(16)9-14-15-12-5-3-4-6-13(12)17-14/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | WBBCKTYQFZBOKM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |