C12H18N2O — CID 142930322
1-(1,3-benzoxazol-2-yl)propan-2-amine;ethane (PubChem CID 142930322) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)propan-2-amine;ethane.
| Compound Name | 1-(1,3-benzoxazol-2-yl)propan-2-amine;ethane |
|---|---|
| PubChem CID | 142930322 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)propan-2-amine;ethane |
| SMILES | CC.CC(N)Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C10H12N2O.C2H6/c1-7(11)6-10-12-8-4-2-3-5-9(8)13-10;1-2/h2-5,7H,6,11H2,1H3;1-2H3 |
| InChIKey | SEARIENCANRYSO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |