C15H16N2O2 — CID 43118536
2-(1,3-benzoxazol-2-yl)-1-(2,5-dimethylfuran-3-yl)ethanamine (PubChem CID 43118536) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(2,5-dimethylfuran-3-yl)ethanamine.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(2,5-dimethylfuran-3-yl)ethanamine |
|---|---|
| PubChem CID | 43118536 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(2,5-dimethylfuran-3-yl)ethanamine |
| SMILES | Cc1cc(C(N)Cc2nc3ccccc3o2)c(C)o1 |
| InChI | InChI=1S/C15H16N2O2/c1-9-7-11(10(2)18-9)12(16)8-15-17-13-5-3-4-6-14(13)19-15/h3-7,12H,8,16H2,1-2H3 |
| InChIKey | SZSXAINEFGSBGD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |