C17H16ClNO — CID 66460334
2-[2-chloro-2-(3,5-dimethylphenyl)ethyl]-1,3-benzoxazole (PubChem CID 66460334) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-[2-chloro-2-(3,5-dimethylphenyl)ethyl]-1,3-benzoxazole.
| Compound Name | 2-[2-chloro-2-(3,5-dimethylphenyl)ethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 66460334 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-[2-chloro-2-(3,5-dimethylphenyl)ethyl]-1,3-benzoxazole |
| SMILES | Cc1cc(C)cc(C(Cl)Cc2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C17H16ClNO/c1-11-7-12(2)9-13(8-11)14(18)10-17-19-15-5-3-4-6-16(15)20-17/h3-9,14H,10H2,1-2H3 |
| InChIKey | ZEBNENVLVBEKTJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|