C14H12ClNOS — CID 66459124
2-[2-chloro-2-(5-methylthiophen-2-yl)ethyl]-1,3-benzoxazole (PubChem CID 66459124) has the molecular formula C14H12ClNOS and a molecular weight of 277.78 g/mol. Its IUPAC name is 2-[2-chloro-2-(5-methylthiophen-2-yl)ethyl]-1,3-benzoxazole.
| Compound Name | 2-[2-chloro-2-(5-methylthiophen-2-yl)ethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 66459124 |
| Molecular Formula | C14H12ClNOS |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2-[2-chloro-2-(5-methylthiophen-2-yl)ethyl]-1,3-benzoxazole |
| SMILES | Cc1ccc(C(Cl)Cc2nc3ccccc3o2)s1 |
| InChI | InChI=1S/C14H12ClNOS/c1-9-6-7-13(18-9)10(15)8-14-16-11-4-2-3-5-12(11)17-14/h2-7,10H,8H2,1H3 |
| InChIKey | CCPZHHQQUWKXTN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|