C15H14ClNOS — CID 66461542
2-[2-chloro-2-(4,5-dimethylthiophen-2-yl)ethyl]-1,3-benzoxazole (PubChem CID 66461542) has the molecular formula C15H14ClNOS and a molecular weight of 291.80 g/mol. Its IUPAC name is 2-[2-chloro-2-(4,5-dimethylthiophen-2-yl)ethyl]-1,3-benzoxazole.
| Compound Name | 2-[2-chloro-2-(4,5-dimethylthiophen-2-yl)ethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 66461542 |
| Molecular Formula | C15H14ClNOS |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-[2-chloro-2-(4,5-dimethylthiophen-2-yl)ethyl]-1,3-benzoxazole |
| SMILES | Cc1cc(C(Cl)Cc2nc3ccccc3o2)sc1C |
| InChI | InChI=1S/C15H14ClNOS/c1-9-7-14(19-10(9)2)11(16)8-15-17-12-5-3-4-6-13(12)18-15/h3-7,11H,8H2,1-2H3 |
| InChIKey | QGIFTIRTALPEIN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|