C18H18BrNO — CID 66461842
2-[2-bromo-2-(2,4,6-trimethylphenyl)ethyl]-1,3-benzoxazole (PubChem CID 66461842) has the molecular formula C18H18BrNO and a molecular weight of 344.25 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,4,6-trimethylphenyl)ethyl]-1,3-benzoxazole.
| Compound Name | 2-[2-bromo-2-(2,4,6-trimethylphenyl)ethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 66461842 |
| Molecular Formula | C18H18BrNO |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-[2-bromo-2-(2,4,6-trimethylphenyl)ethyl]-1,3-benzoxazole |
| SMILES | Cc1cc(C)c(C(Br)Cc2nc3ccccc3o2)c(C)c1 |
| InChI | InChI=1S/C18H18BrNO/c1-11-8-12(2)18(13(3)9-11)14(19)10-17-20-15-6-4-5-7-16(15)21-17/h4-9,14H,10H2,1-3H3 |
| InChIKey | OHYQEOXGWDLRMV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|