C19H23NO — CID 142549567
2-[2-(2,4-dimethylphenyl)propyl]-1,3-benzoxazole;methane (PubChem CID 142549567) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)propyl]-1,3-benzoxazole;methane.
| Compound Name | 2-[2-(2,4-dimethylphenyl)propyl]-1,3-benzoxazole;methane |
|---|---|
| PubChem CID | 142549567 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)propyl]-1,3-benzoxazole;methane |
| SMILES | C.Cc1ccc(C(C)Cc2nc3ccccc3o2)c(C)c1 |
| InChI | InChI=1S/C18H19NO.CH4/c1-12-8-9-15(13(2)10-12)14(3)11-18-19-16-6-4-5-7-17(16)20-18;/h4-10,14H,11H2,1-3H3;1H4 |
| InChIKey | FSJJPRQVVQQBAY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |