C13H8Br3NOS — CID 107967289
2-[2-bromo-2-(2,5-dibromothiophen-3-yl)ethyl]-1,3-benzoxazole (PubChem CID 107967289) has the molecular formula C13H8Br3NOS and a molecular weight of 465.99 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,5-dibromothiophen-3-yl)ethyl]-1,3-benzoxazole.
| Compound Name | 2-[2-bromo-2-(2,5-dibromothiophen-3-yl)ethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 107967289 |
| Molecular Formula | C13H8Br3NOS |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 462.79 |
| IUPAC Name | 2-[2-bromo-2-(2,5-dibromothiophen-3-yl)ethyl]-1,3-benzoxazole |
| SMILES | Brc1cc(C(Br)Cc2nc3ccccc3o2)c(Br)s1 |
| InChI | InChI=1S/C13H8Br3NOS/c14-8(7-5-11(15)19-13(7)16)6-12-17-9-3-1-2-4-10(9)18-12/h1-5,8H,6H2 |
| InChIKey | PCHHDQVBFFNJGE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|