C15H11BrClNO — CID 66461939
2-[2-(2-bromophenyl)-2-chloroethyl]-1,3-benzoxazole (PubChem CID 66461939) has the molecular formula C15H11BrClNO and a molecular weight of 336.62 g/mol. Its IUPAC name is 2-[2-(2-bromophenyl)-2-chloroethyl]-1,3-benzoxazole.
| Compound Name | 2-[2-(2-bromophenyl)-2-chloroethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 66461939 |
| Molecular Formula | C15H11BrClNO |
| Molecular Weight | 336.62 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | 2-[2-(2-bromophenyl)-2-chloroethyl]-1,3-benzoxazole |
| SMILES | ClC(Cc1nc2ccccc2o1)c1ccccc1Br |
| InChI | InChI=1S/C15H11BrClNO/c16-11-6-2-1-5-10(11)12(17)9-15-18-13-7-3-4-8-14(13)19-15/h1-8,12H,9H2 |
| InChIKey | TVYDLJROAPNEPB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|