C15H12Br2N2O — CID 107980650
2-(1,3-benzoxazol-2-yl)-1-(3,5-dibromophenyl)ethanamine (PubChem CID 107980650) has the molecular formula C15H12Br2N2O and a molecular weight of 396.08 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(3,5-dibromophenyl)ethanamine.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(3,5-dibromophenyl)ethanamine |
|---|---|
| PubChem CID | 107980650 |
| Molecular Formula | C15H12Br2N2O |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(3,5-dibromophenyl)ethanamine |
| SMILES | NC(Cc1nc2ccccc2o1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C15H12Br2N2O/c16-10-5-9(6-11(17)7-10)12(18)8-15-19-13-3-1-2-4-14(13)20-15/h1-7,12H,8,18H2 |
| InChIKey | VGELTVMXGLMNJO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |