C16H11Cl2N3O3 — CID 174229934
[[1-amino-2-(1,3-benzoxazol-2-yl)ethylidene]amino] 3,5-dichlorobenzoate (PubChem CID 174229934) has the molecular formula C16H11Cl2N3O3 and a molecular weight of 364.19 g/mol. Its IUPAC name is [[1-amino-2-(1,3-benzoxazol-2-yl)ethylidene]amino] 3,5-dichlorobenzoate.
| Compound Name | [[1-amino-2-(1,3-benzoxazol-2-yl)ethylidene]amino] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 174229934 |
| Molecular Formula | C16H11Cl2N3O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | [[1-amino-2-(1,3-benzoxazol-2-yl)ethylidene]amino] 3,5-dichlorobenzoate |
| SMILES | NC(Cc1nc2ccccc2o1)=NOC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2N3O3/c17-10-5-9(6-11(18)7-10)16(22)24-21-14(19)8-15-20-12-3-1-2-4-13(12)23-15/h1-7H,8H2,(H2,19,21) |
| InChIKey | CVXCOHLXIFTMOG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|