C19H15N5O4S — CID 174224692
[[1-amino-2-(1,3-benzoxazol-2-yl)ethylidene]amino] 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate (PubChem CID 174224692) has the molecular formula C19H15N5O4S and a molecular weight of 409.43 g/mol. Its IUPAC name is [[1-amino-2-(1,3-benzoxazol-2-yl)ethylidene]amino] 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate.
| Compound Name | [[1-amino-2-(1,3-benzoxazol-2-yl)ethylidene]amino] 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 174224692 |
| Molecular Formula | C19H15N5O4S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [[1-amino-2-(1,3-benzoxazol-2-yl)ethylidene]amino] 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
| SMILES | NC(Cc1nc2ccccc2o1)=NOC(=O)CSc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H15N5O4S/c20-15(10-16-21-13-8-4-5-9-14(13)26-16)24-28-17(25)11-29-19-23-22-18(27-19)12-6-2-1-3-7-12/h1-9H,10-11H2,(H2,20,24) |
| InChIKey | GARQHUABMPUZKQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|