C16H13NO3S — CID 690612
benzyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate (PubChem CID 690612) has the molecular formula C16H13NO3S and a molecular weight of 299.35 g/mol. Its IUPAC name is benzyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate.
| Compound Name | benzyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 690612 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | benzyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate |
| SMILES | O=C(CSc1nc2ccccc2o1)OCc1ccccc1 |
| InChI | InChI=1S/C16H13NO3S/c18-15(19-10-12-6-2-1-3-7-12)11-21-16-17-13-8-4-5-9-14(13)20-16/h1-9H,10-11H2 |
| InChIKey | UKUMXIWZUHRRLF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |