C19H20N2O2S — CID 52888357
2-(1,3-benzoxazol-2-ylsulfanyl)-N-benzyl-N-propan-2-ylacetamide (PubChem CID 52888357) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-benzyl-N-propan-2-ylacetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-benzyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 52888357 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-benzyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C19H20N2O2S/c1-14(2)21(12-15-8-4-3-5-9-15)18(22)13-24-19-20-16-10-6-7-11-17(16)23-19/h3-11,14H,12-13H2,1-2H3 |
| InChIKey | UWHYQDCOELFURT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |