C18H17NO5S2 — CID 55821968
3-(benzenesulfonyl)propyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate (PubChem CID 55821968) has the molecular formula C18H17NO5S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-(benzenesulfonyl)propyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate.
| Compound Name | 3-(benzenesulfonyl)propyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 55821968 |
| Molecular Formula | C18H17NO5S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 3-(benzenesulfonyl)propyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate |
| SMILES | O=C(CSc1nc2ccccc2o1)OCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17NO5S2/c20-17(13-25-18-19-15-9-4-5-10-16(15)24-18)23-11-6-12-26(21,22)14-7-2-1-3-8-14/h1-5,7-10H,6,11-13H2 |
| InChIKey | VOSVCDJKXVJCAO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|