C17H14ClNO4S — CID 7835977
2-(2-chlorophenoxy)ethyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate (PubChem CID 7835977) has the molecular formula C17H14ClNO4S and a molecular weight of 363.82 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate.
| Compound Name | 2-(2-chlorophenoxy)ethyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 7835977 |
| Molecular Formula | C17H14ClNO4S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl 2-(1,3-benzoxazol-2-ylsulfanyl)acetate |
| SMILES | O=C(CSc1nc2ccccc2o1)OCCOc1ccccc1Cl |
| InChI | InChI=1S/C17H14ClNO4S/c18-12-5-1-3-7-14(12)21-9-10-22-16(20)11-24-17-19-13-6-2-4-8-15(13)23-17/h1-8H,9-11H2 |
| InChIKey | OBIPQFQPONSXJM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|