C16H20N2O3S — CID 19205113
hexyl 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate (PubChem CID 19205113) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is hexyl 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate.
| Compound Name | hexyl 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 19205113 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | hexyl 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetate |
| SMILES | CCCCCCOC(=O)CSc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H20N2O3S/c1-2-3-4-8-11-20-14(19)12-22-16-18-17-15(21-16)13-9-6-5-7-10-13/h5-7,9-10H,2-4,8,11-12H2,1H3 |
| InChIKey | OWBLBOKAQGGIKJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|