C42H50N4O6S2 — CID 101213549
bis[4-(5-nonylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl] benzene-1,3-dicarboxylate (PubChem CID 101213549) has the molecular formula C42H50N4O6S2 and a molecular weight of 771.02 g/mol. Its IUPAC name is bis[4-(5-nonylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl] benzene-1,3-dicarboxylate.
| Compound Name | bis[4-(5-nonylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101213549 |
| Molecular Formula | C42H50N4O6S2 |
| Molecular Weight | 771.02 g/mol |
| Exact Mass | 770.32 |
| IUPAC Name | bis[4-(5-nonylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl] benzene-1,3-dicarboxylate |
| SMILES | CCCCCCCCCSc1nnc(-c2ccc(OC(=O)c3cccc(C(=O)Oc4ccc(-c5nnc(SCCCCCCCCC)o5)cc4)c3)cc2)o1 |
| InChI | InChI=1S/C42H50N4O6S2/c1-3-5-7-9-11-13-15-28-53-41-45-43-37(51-41)31-20-24-35(25-21-31)49-39(47)33-18-17-19-34(30-33)40(48)50-36-26-22-32(23-27-36)38-44-46-42(52-38)54-29-16-14-12-10-8-6-4-2/h17-27,30H,3-16,28-29H2,1-2H3 |
| InChIKey | OXISRPHCOJETKH-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 130.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.02 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|