C34H36N4O6S3 — CID 101213539
bis[4-(5-hexylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl] thiophene-2,5-dicarboxylate (PubChem CID 101213539) has the molecular formula C34H36N4O6S3 and a molecular weight of 692.89 g/mol. Its IUPAC name is bis[4-(5-hexylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl] thiophene-2,5-dicarboxylate.
| Compound Name | bis[4-(5-hexylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl] thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 101213539 |
| Molecular Formula | C34H36N4O6S3 |
| Molecular Weight | 692.89 g/mol |
| Exact Mass | 692.18 |
| IUPAC Name | bis[4-(5-hexylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl] thiophene-2,5-dicarboxylate |
| SMILES | CCCCCCSc1nnc(-c2ccc(OC(=O)c3ccc(C(=O)Oc4ccc(-c5nnc(SCCCCCC)o5)cc4)s3)cc2)o1 |
| InChI | InChI=1S/C34H36N4O6S3/c1-3-5-7-9-21-45-33-37-35-29(43-33)23-11-15-25(16-12-23)41-31(39)27-19-20-28(47-27)32(40)42-26-17-13-24(14-18-26)30-36-38-34(44-30)46-22-10-8-6-4-2/h11-20H,3-10,21-22H2,1-2H3 |
| InChIKey | TXWJFMMCYYMXGN-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 130.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.89 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|