C13H22N2O3S — CID 116699752
ethyl 5-octylsulfanyl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 116699752) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is ethyl 5-octylsulfanyl-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | ethyl 5-octylsulfanyl-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 116699752 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 5-octylsulfanyl-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCCCCCCCSc1nnc(C(=O)OCC)o1 |
| InChI | InChI=1S/C13H22N2O3S/c1-3-5-6-7-8-9-10-19-13-15-14-11(18-13)12(16)17-4-2/h3-10H2,1-2H3 |
| InChIKey | SXCQCJGURKTAES-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|