ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate

C13H14N2O3S — CID 116700189

IUPACethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate
SMILESCCOC(=O)c1nnc(SC(C)c2ccccc2)o1
InChIInChI=1S/C13H14N2O3S/c1-3-17-12(16)11-14-15-13(18-11)19-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3
InChIKeyZPKPRXYLKAILCC-UHFFFAOYSA-N
MW278.33 g/mol
LogP3.10
Rot. Bonds5

About ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate

ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 116700189) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate.

Molecular Properties

Compound Nameethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate
PubChem CID116700189
Molecular FormulaC13H14N2O3S
Molecular Weight278.33 g/mol
Exact Mass278.07
IUPAC Nameethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate
SMILESCCOC(=O)c1nnc(SC(C)c2ccccc2)o1
InChIInChI=1S/C13H14N2O3S/c1-3-17-12(16)11-14-15-13(18-11)19-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3
InChIKeyZPKPRXYLKAILCC-UHFFFAOYSA-N
XLogP3.10
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.33
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate (CID 116700189) is ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate is CCOC(=O)c1nnc(SC(C)c2ccccc2)o1.
What is the InChIKey of ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is ZPKPRXYLKAILCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3S/c1-3-17-12(16)11-14-15-13(18-11)19-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3.
What are the key properties of ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate?
ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 278.33 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(1-phenylethylsulfanyl)-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 116700189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).