About ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate
ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 112619344) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate |
| PubChem CID | 112619344 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCCCCCCCc1nnc(C(=O)OCC)o1 |
| InChI | InChI=1S/C13H22N2O3/c1-3-5-6-7-8-9-10-11-14-15-12(18-11)13(16)17-4-2/h3-10H2,1-2H3 |
| InChIKey | FHDHDCVXYSXRKW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate (CID 112619344) is ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate is CCCCCCCCc1nnc(C(=O)OCC)o1.
What is the InChIKey of ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is FHDHDCVXYSXRKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3/c1-3-5-6-7-8-9-10-11-14-15-12(18-11)13(16)17-4-2/h3-10H2,1-2H3.
What are the key properties of ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate?
ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 254.33 g/mol, XLogP of 3.15, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-octyl-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 112619344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).