C8H12N2O4 — CID 112619032
methyl 5-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 112619032) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is methyl 5-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | methyl 5-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 112619032 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | methyl 5-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxylate |
| SMILES | COCCCc1nnc(C(=O)OC)o1 |
| InChI | InChI=1S/C8H12N2O4/c1-12-5-3-4-6-9-10-7(14-6)8(11)13-2/h3-5H2,1-2H3 |
| InChIKey | TXLJWCBHWDXFEP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|