C8H10F2N2O4 — CID 103210021
methyl 5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole-2-carboxylate (PubChem CID 103210021) has the molecular formula C8H10F2N2O4 and a molecular weight of 236.17 g/mol. Its IUPAC name is methyl 5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | methyl 5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 103210021 |
| Molecular Formula | C8H10F2N2O4 |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | methyl 5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole-2-carboxylate |
| SMILES | COC(=O)c1nnc(CCOCC(F)F)o1 |
| InChI | InChI=1S/C8H10F2N2O4/c1-14-8(13)7-12-11-6(16-7)2-3-15-4-5(9)10/h5H,2-4H2,1H3 |
| InChIKey | GMKRTAMZRIIFIB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|