C13H23F2N3O2 — CID 103212000
N-[3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]propyl]-2-methylpropan-2-amine (PubChem CID 103212000) has the molecular formula C13H23F2N3O2 and a molecular weight of 291.34 g/mol. Its IUPAC name is N-[3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]propyl]-2-methylpropan-2-amine.
| Compound Name | N-[3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 103212000 |
| Molecular Formula | C13H23F2N3O2 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-[3-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazol-2-yl]propyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCCCc1nnc(CCOCC(F)F)o1 |
| InChI | InChI=1S/C13H23F2N3O2/c1-13(2,3)16-7-4-5-11-17-18-12(20-11)6-8-19-9-10(14)15/h10,16H,4-9H2,1-3H3 |
| InChIKey | COAMUMHCVSVVLQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|