C12H21F2N3O — CID 103150869
N-[[2-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazol-5-yl]methyl]-2-methylpropan-2-amine (PubChem CID 103150869) has the molecular formula C12H21F2N3O and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[[2-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazol-5-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazol-5-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 103150869 |
| Molecular Formula | C12H21F2N3O |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[[2-[2-(2,2-difluoroethoxy)ethyl]-1H-imidazol-5-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cnc(CCOCC(F)F)[nH]1 |
| InChI | InChI=1S/C12H21F2N3O/c1-12(2,3)16-7-9-6-15-11(17-9)4-5-18-8-10(13)14/h6,10,16H,4-5,7-8H2,1-3H3,(H,15,17) |
| InChIKey | AFBGQTLKMFQRML-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|