C11H20F2N4O — CID 82005716
N-[[1-[2-(2,2-difluoroethoxy)ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 82005716) has the molecular formula C11H20F2N4O and a molecular weight of 262.30 g/mol. Its IUPAC name is N-[[1-[2-(2,2-difluoroethoxy)ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[2-(2,2-difluoroethoxy)ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 82005716 |
| Molecular Formula | C11H20F2N4O |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | N-[[1-[2-(2,2-difluoroethoxy)ethyl]triazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cn(CCOCC(F)F)nn1 |
| InChI | InChI=1S/C11H20F2N4O/c1-11(2,3)14-6-9-7-17(16-15-9)4-5-18-8-10(12)13/h7,10,14H,4-6,8H2,1-3H3 |
| InChIKey | QZNLNHGEJQSFMY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|